C13H16BrF2NO — CID 107322118
N-(5-bromopentyl)-2,4-difluoro-5-methylbenzamide (PubChem CID 107322118) has the molecular formula C13H16BrF2NO and a molecular weight of 320.18 g/mol. Its IUPAC name is N-(5-bromopentyl)-2,4-difluoro-5-methylbenzamide.
| Compound Name | N-(5-bromopentyl)-2,4-difluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 107322118 |
| Molecular Formula | C13H16BrF2NO |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N-(5-bromopentyl)-2,4-difluoro-5-methylbenzamide |
| SMILES | Cc1cc(C(=O)NCCCCCBr)c(F)cc1F |
| InChI | InChI=1S/C13H16BrF2NO/c1-9-7-10(12(16)8-11(9)15)13(18)17-6-4-2-3-5-14/h7-8H,2-6H2,1H3,(H,17,18) |
| InChIKey | XQLFUPCZZLRLJV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|