C13H15BrF3NO — CID 107847891
N-(6-bromohexyl)-2,4,6-trifluorobenzamide (PubChem CID 107847891) has the molecular formula C13H15BrF3NO and a molecular weight of 338.17 g/mol. Its IUPAC name is N-(6-bromohexyl)-2,4,6-trifluorobenzamide.
| Compound Name | N-(6-bromohexyl)-2,4,6-trifluorobenzamide |
|---|---|
| PubChem CID | 107847891 |
| Molecular Formula | C13H15BrF3NO |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | N-(6-bromohexyl)-2,4,6-trifluorobenzamide |
| SMILES | O=C(NCCCCCCBr)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H15BrF3NO/c14-5-3-1-2-4-6-18-13(19)12-10(16)7-9(15)8-11(12)17/h7-8H,1-6H2,(H,18,19) |
| InChIKey | ICLXHKBZQUVUGB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|