C14H20BrNO — CID 107321862
N-(5-bromopentyl)-2,4-dimethylbenzamide (PubChem CID 107321862) has the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. Its IUPAC name is N-(5-bromopentyl)-2,4-dimethylbenzamide.
| Compound Name | N-(5-bromopentyl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 107321862 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-(5-bromopentyl)-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCCCCBr)c(C)c1 |
| InChI | InChI=1S/C14H20BrNO/c1-11-6-7-13(12(2)10-11)14(17)16-9-5-3-4-8-15/h6-7,10H,3-5,8-9H2,1-2H3,(H,16,17) |
| InChIKey | MIJYOJSYRQWIJA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|