C14H23NO2 — CID 178149105
ethane;N-(2-methoxyethyl)-2,4-dimethylbenzamide (PubChem CID 178149105) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is ethane;N-(2-methoxyethyl)-2,4-dimethylbenzamide.
| Compound Name | ethane;N-(2-methoxyethyl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 178149105 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | ethane;N-(2-methoxyethyl)-2,4-dimethylbenzamide |
| SMILES | CC.COCCNC(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C12H17NO2.C2H6/c1-9-4-5-11(10(2)8-9)12(14)13-6-7-15-3;1-2/h4-5,8H,6-7H2,1-3H3,(H,13,14);1-2H3 |
| InChIKey | PPJMAKOYENDKFX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|