C14H18F3NO2 — CID 86929041
2,4-dimethyl-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide (PubChem CID 86929041) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 2,4-dimethyl-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide |
|---|---|
| PubChem CID | 86929041 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2,4-dimethyl-N-[3-(2,2,2-trifluoroethoxy)propyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCCCOCC(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C14H18F3NO2/c1-10-4-5-12(11(2)8-10)13(19)18-6-3-7-20-9-14(15,16)17/h4-5,8H,3,6-7,9H2,1-2H3,(H,18,19) |
| InChIKey | MZXXDWJJWMLLBH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|