C19H23NO2 — CID 95161709
N-[2-(3,5-dimethylphenoxy)ethyl]-2,4-dimethylbenzamide (PubChem CID 95161709) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenoxy)ethyl]-2,4-dimethylbenzamide.
| Compound Name | N-[2-(3,5-dimethylphenoxy)ethyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 95161709 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-[2-(3,5-dimethylphenoxy)ethyl]-2,4-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(OCCNC(=O)c2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C19H23NO2/c1-13-5-6-18(16(4)10-13)19(21)20-7-8-22-17-11-14(2)9-15(3)12-17/h5-6,9-12H,7-8H2,1-4H3,(H,20,21) |
| InChIKey | XBOHLWJCDXILAA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|