C13H18INO — CID 106846408
N-(4-iodobutyl)-2,4-dimethylbenzamide (PubChem CID 106846408) has the molecular formula C13H18INO and a molecular weight of 331.20 g/mol. Its IUPAC name is N-(4-iodobutyl)-2,4-dimethylbenzamide.
| Compound Name | N-(4-iodobutyl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 106846408 |
| Molecular Formula | C13H18INO |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-(4-iodobutyl)-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCCCI)c(C)c1 |
| InChI | InChI=1S/C13H18INO/c1-10-5-6-12(11(2)9-10)13(16)15-8-4-3-7-14/h5-6,9H,3-4,7-8H2,1-2H3,(H,15,16) |
| InChIKey | OEMOECAVPSOXDF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|