2-[2-(3,5-dimethylphenoxy)ethylamino]-2-oxoacetic acid

C12H15NO4 — CID 82129666

IUPAC2-[2-(3,5-dimethylphenoxy)ethylamino]-2-oxoacetic acid
SMILESCc1cc(C)cc(OCCNC(=O)C(=O)O)c1
InChIInChI=1S/C12H15NO4/c1-8-5-9(2)7-10(6-8)17-4-3-13-11(14)12(15)16/h5-7H,3-4H2,1-2H3,(H,13,14)(H,15,16)
InChIKeyIRIFBQJAIPQIET-UHFFFAOYSA-N
MW237.25 g/mol
LogP0.88
Rot. Bonds4

About 2-[2-(3,5-dimethylphenoxy)ethylamino]-2-oxoacetic acid

2-[2-(3,5-dimethylphenoxy)ethylamino]-2-oxoacetic acid (PubChem CID 82129666) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylphenoxy)ethylamino]-2-oxoacetic acid.

Molecular Properties

Compound Name2-[2-(3,5-dimethylphenoxy)ethylamino]-2-oxoacetic acid
PubChem CID82129666
Molecular FormulaC12H15NO4
Molecular Weight237.25 g/mol
Exact Mass237.10
IUPAC Name2-[2-(3,5-dimethylphenoxy)ethylamino]-2-oxoacetic acid
SMILESCc1cc(C)cc(OCCNC(=O)C(=O)O)c1
InChIInChI=1S/C12H15NO4/c1-8-5-9(2)7-10(6-8)17-4-3-13-11(14)12(15)16/h5-7H,3-4H2,1-2H3,(H,13,14)(H,15,16)
InChIKeyIRIFBQJAIPQIET-UHFFFAOYSA-N
XLogP0.88
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.25
LogP ≤ 50.88
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-[2-(3,5-dimethylphenoxy)ethylamino]-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(3,5-dimethylphenoxy)ethylamino]-2-oxoacetic acid?
The IUPAC name of 2-[2-(3,5-dimethylphenoxy)ethylamino]-2-oxoacetic acid (CID 82129666) is 2-[2-(3,5-dimethylphenoxy)ethylamino]-2-oxoacetic acid.
What is the SMILES notation for 2-[2-(3,5-dimethylphenoxy)ethylamino]-2-oxoacetic acid?
The canonical SMILES for 2-[2-(3,5-dimethylphenoxy)ethylamino]-2-oxoacetic acid is Cc1cc(C)cc(OCCNC(=O)C(=O)O)c1.
What is the InChIKey of 2-[2-(3,5-dimethylphenoxy)ethylamino]-2-oxoacetic acid?
The InChIKey is IRIFBQJAIPQIET-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c1-8-5-9(2)7-10(6-8)17-4-3-13-11(14)12(15)16/h5-7H,3-4H2,1-2H3,(H,13,14)(H,15,16).
What are the key properties of 2-[2-(3,5-dimethylphenoxy)ethylamino]-2-oxoacetic acid?
2-[2-(3,5-dimethylphenoxy)ethylamino]-2-oxoacetic acid has a molecular weight of 237.25 g/mol, XLogP of 0.88, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,5-dimethylphenoxy)ethylamino]-2-oxoacetic acid is sourced from PubChem (CID 82129666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).