C19H23NO2S — CID 133166181
N-[2-(3,5-dimethylphenoxy)ethyl]-2-phenylsulfanylpropanamide (PubChem CID 133166181) has the molecular formula C19H23NO2S and a molecular weight of 329.47 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenoxy)ethyl]-2-phenylsulfanylpropanamide.
| Compound Name | N-[2-(3,5-dimethylphenoxy)ethyl]-2-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 133166181 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-[2-(3,5-dimethylphenoxy)ethyl]-2-phenylsulfanylpropanamide |
| SMILES | Cc1cc(C)cc(OCCNC(=O)C(C)Sc2ccccc2)c1 |
| InChI | InChI=1S/C19H23NO2S/c1-14-11-15(2)13-17(12-14)22-10-9-20-19(21)16(3)23-18-7-5-4-6-8-18/h4-8,11-13,16H,9-10H2,1-3H3,(H,20,21) |
| InChIKey | LMKGEVQSEKXLJY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|