C17H25NO2 — CID 2994102
N-[2-(3,5-dimethylphenoxy)ethyl]cyclohexanecarboxamide (PubChem CID 2994102) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenoxy)ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-(3,5-dimethylphenoxy)ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 2994102 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-[2-(3,5-dimethylphenoxy)ethyl]cyclohexanecarboxamide |
| SMILES | Cc1cc(C)cc(OCCNC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C17H25NO2/c1-13-10-14(2)12-16(11-13)20-9-8-18-17(19)15-6-4-3-5-7-15/h10-12,15H,3-9H2,1-2H3,(H,18,19) |
| InChIKey | JVABBQDQCRPRQP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|