C18H27NO2 — CID 94868061
N-[2-(4-tert-butylphenoxy)ethyl]cyclopentanecarboxamide (PubChem CID 94868061) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]cyclopentanecarboxamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 94868061 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]cyclopentanecarboxamide |
| SMILES | CC(C)(C)c1ccc(OCCNC(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C18H27NO2/c1-18(2,3)15-8-10-16(11-9-15)21-13-12-19-17(20)14-6-4-5-7-14/h8-11,14H,4-7,12-13H2,1-3H3,(H,19,20) |
| InChIKey | KZBFMSWOUNCTOD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|