C22H32N2O3 — CID 31336587
N-[2-(4-tert-butylphenoxy)ethyl]-1-(cyclopropanecarbonyl)piperidine-4-carboxamide (PubChem CID 31336587) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]-1-(cyclopropanecarbonyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]-1-(cyclopropanecarbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 31336587 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]-1-(cyclopropanecarbonyl)piperidine-4-carboxamide |
| SMILES | CC(C)(C)c1ccc(OCCNC(=O)C2CCN(C(=O)C3CC3)CC2)cc1 |
| InChI | InChI=1S/C22H32N2O3/c1-22(2,3)18-6-8-19(9-7-18)27-15-12-23-20(25)16-10-13-24(14-11-16)21(26)17-4-5-17/h6-9,16-17H,4-5,10-15H2,1-3H3,(H,23,25) |
| InChIKey | JZSLKNHMVSDCCY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|