C19H23F3N2O3 — CID 55803507
1-(cyclopropanecarbonyl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]piperidine-4-carboxamide (PubChem CID 55803507) has the molecular formula C19H23F3N2O3 and a molecular weight of 384.40 g/mol. Its IUPAC name is 1-(cyclopropanecarbonyl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(cyclopropanecarbonyl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55803507 |
| Molecular Formula | C19H23F3N2O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-(cyclopropanecarbonyl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCOc1ccc(C(F)(F)F)cc1)C1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C19H23F3N2O3/c20-19(21,22)15-3-5-16(6-4-15)27-12-9-23-17(25)13-7-10-24(11-8-13)18(26)14-1-2-14/h3-6,13-14H,1-2,7-12H2,(H,23,25) |
| InChIKey | XYLOQZQSOLLWER-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|