C14H16F3NO4S — CID 55803512
1,1-dioxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]thiolane-3-carboxamide (PubChem CID 55803512) has the molecular formula C14H16F3NO4S and a molecular weight of 351.35 g/mol. Its IUPAC name is 1,1-dioxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]thiolane-3-carboxamide.
| Compound Name | 1,1-dioxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]thiolane-3-carboxamide |
|---|---|
| PubChem CID | 55803512 |
| Molecular Formula | C14H16F3NO4S |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 1,1-dioxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]thiolane-3-carboxamide |
| SMILES | O=C(NCCOc1ccc(C(F)(F)F)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16F3NO4S/c15-14(16,17)11-1-3-12(4-2-11)22-7-6-18-13(19)10-5-8-23(20,21)9-10/h1-4,10H,5-9H2,(H,18,19) |
| InChIKey | WLUJPFWBJFJDQQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|