C18H23F3N2O2 — CID 119736772
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]acetamide (PubChem CID 119736772) has the molecular formula C18H23F3N2O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]acetamide.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 119736772 |
| Molecular Formula | C18H23F3N2O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]acetamide |
| SMILES | O=C(CC1CC2CCC(C1)N2)NCCOc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H23F3N2O2/c19-18(20,21)13-1-5-16(6-2-13)25-8-7-22-17(24)11-12-9-14-3-4-15(10-12)23-14/h1-2,5-6,12,14-15,23H,3-4,7-11H2,(H,22,24) |
| InChIKey | KXSJVLJERRBPEV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|