C17H24BrClN2O2 — CID 119746386
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(3-bromophenoxy)ethyl]acetamide;hydrochloride (PubChem CID 119746386) has the molecular formula C17H24BrClN2O2 and a molecular weight of 403.75 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(3-bromophenoxy)ethyl]acetamide;hydrochloride.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(3-bromophenoxy)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119746386 |
| Molecular Formula | C17H24BrClN2O2 |
| Molecular Weight | 403.75 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-(3-bromophenoxy)ethyl]acetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CC2CCC(C1)N2)NCCOc1cccc(Br)c1 |
| InChI | InChI=1S/C17H23BrN2O2.ClH/c18-13-2-1-3-16(11-13)22-7-6-19-17(21)10-12-8-14-4-5-15(9-12)20-14;/h1-3,11-12,14-15,20H,4-10H2,(H,19,21);1H |
| InChIKey | GOOMBFMIFLVIOX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.75 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|