C16H23Cl4N3O2 — CID 119900851
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]acetamide;dihydrochloride (PubChem CID 119900851) has the molecular formula C16H23Cl4N3O2 and a molecular weight of 431.19 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]acetamide;dihydrochloride.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119900851 |
| Molecular Formula | C16H23Cl4N3O2 |
| Molecular Weight | 431.19 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CC2CCC(C1)N2)NCCOc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C16H21Cl2N3O2.2ClH/c17-11-8-14(18)16(20-9-11)23-4-3-19-15(22)7-10-5-12-1-2-13(6-10)21-12;;/h8-10,12-13,21H,1-7H2,(H,19,22);2*1H |
| InChIKey | KKLCAABNTDNLGO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.19 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|