C18H25Cl2N3O2 — CID 119703573
N-[2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]ethyl]-2-chlorobenzamide;hydrochloride (PubChem CID 119703573) has the molecular formula C18H25Cl2N3O2 and a molecular weight of 386.32 g/mol. Its IUPAC name is N-[2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]ethyl]-2-chlorobenzamide;hydrochloride.
| Compound Name | N-[2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]ethyl]-2-chlorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119703573 |
| Molecular Formula | C18H25Cl2N3O2 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-[2-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]ethyl]-2-chlorobenzamide;hydrochloride |
| SMILES | Cl.O=C(CC1CC2CCC(C1)N2)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C18H24ClN3O2.ClH/c19-16-4-2-1-3-15(16)18(24)21-8-7-20-17(23)11-12-9-13-5-6-14(10-12)22-13;/h1-4,12-14,22H,5-11H2,(H,20,23)(H,21,24);1H |
| InChIKey | GDWQTPNMHJCJDG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|