C17H26ClN3O2S — CID 119764467
N-[3-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]propyl]thiophene-2-carboxamide;hydrochloride (PubChem CID 119764467) has the molecular formula C17H26ClN3O2S and a molecular weight of 371.93 g/mol. Its IUPAC name is N-[3-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]propyl]thiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[3-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]propyl]thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119764467 |
| Molecular Formula | C17H26ClN3O2S |
| Molecular Weight | 371.93 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-[3-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]propyl]thiophene-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(CC1CC2CCC(C1)N2)NCCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C17H25N3O2S.ClH/c21-16(11-12-9-13-4-5-14(10-12)20-13)18-6-2-7-19-17(22)15-3-1-8-23-15;/h1,3,8,12-14,20H,2,4-7,9-11H2,(H,18,21)(H,19,22);1H |
| InChIKey | AGKHYRISFMKZIB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.93 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|