C20H28Cl2N4OS — CID 119875509
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]acetamide;dihydrochloride (PubChem CID 119875509) has the molecular formula C20H28Cl2N4OS and a molecular weight of 443.44 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]acetamide;dihydrochloride.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119875509 |
| Molecular Formula | C20H28Cl2N4OS |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CC2CCC(C1)N2)NCCCc1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C20H26N4OS.2ClH/c25-19(12-14-10-16-3-4-17(11-14)23-16)22-7-1-2-20-24-18(13-26-20)15-5-8-21-9-6-15;;/h5-6,8-9,13-14,16-17,23H,1-4,7,10-12H2,(H,22,25);2*1H |
| InChIKey | VAOJGGXHZALBBJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|