C20H18N4OS3 — CID 166187850
N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 166187850) has the molecular formula C20H18N4OS3 and a molecular weight of 426.59 g/mol. Its IUPAC name is N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 166187850 |
| Molecular Formula | C20H18N4OS3 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | O=C(Cc1csc(-c2ccsc2)n1)NCCCc1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C20H18N4OS3/c25-18(10-16-12-28-20(23-16)15-5-9-26-11-15)22-6-1-2-19-24-17(13-27-19)14-3-7-21-8-4-14/h3-5,7-9,11-13H,1-2,6,10H2,(H,22,25) |
| InChIKey | OOFSREXQULKPQC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|