C19H15BrN4OS3 — CID 51136003
2-(4-bromothiophen-2-yl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-1,3-thiazole-4-carboxamide (PubChem CID 51136003) has the molecular formula C19H15BrN4OS3 and a molecular weight of 491.46 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-bromothiophen-2-yl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 51136003 |
| Molecular Formula | C19H15BrN4OS3 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 489.96 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCCc1nc(-c2ccncc2)cs1)c1csc(-c2cc(Br)cs2)n1 |
| InChI | InChI=1S/C19H15BrN4OS3/c20-13-8-16(26-9-13)19-24-15(11-28-19)18(25)22-5-1-2-17-23-14(10-27-17)12-3-6-21-7-4-12/h3-4,6-11H,1-2,5H2,(H,22,25) |
| InChIKey | URWRXUNBWPIQIM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|