C16H14BrN3O2S3 — CID 52816467
2-(4-bromothiophen-2-yl)-N-[3-(thiophene-2-carbonylamino)propyl]-1,3-thiazole-4-carboxamide (PubChem CID 52816467) has the molecular formula C16H14BrN3O2S3 and a molecular weight of 456.41 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-N-[3-(thiophene-2-carbonylamino)propyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-bromothiophen-2-yl)-N-[3-(thiophene-2-carbonylamino)propyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 52816467 |
| Molecular Formula | C16H14BrN3O2S3 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 454.94 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-N-[3-(thiophene-2-carbonylamino)propyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCCNC(=O)c1cccs1)c1csc(-c2cc(Br)cs2)n1 |
| InChI | InChI=1S/C16H14BrN3O2S3/c17-10-7-13(24-8-10)16-20-11(9-25-16)14(21)18-4-2-5-19-15(22)12-3-1-6-23-12/h1,3,6-9H,2,4-5H2,(H,18,21)(H,19,22) |
| InChIKey | LTPTYIKSSYATDJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|