C17H21N3O2S2 — CID 46537541
N-[3-(2-oxoazepan-1-yl)propyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 46537541) has the molecular formula C17H21N3O2S2 and a molecular weight of 363.51 g/mol. Its IUPAC name is N-[3-(2-oxoazepan-1-yl)propyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[3-(2-oxoazepan-1-yl)propyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46537541 |
| Molecular Formula | C17H21N3O2S2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-[3-(2-oxoazepan-1-yl)propyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCCN1CCCCCC1=O)c1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C17H21N3O2S2/c21-15-7-2-1-3-9-20(15)10-5-8-18-16(22)13-12-24-17(19-13)14-6-4-11-23-14/h4,6,11-12H,1-3,5,7-10H2,(H,18,22) |
| InChIKey | OOESLUNJZWSCIM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|