C17H15N3O2S2 — CID 55536744
N-(2-benzamidoethyl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 55536744) has the molecular formula C17H15N3O2S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is N-(2-benzamidoethyl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-benzamidoethyl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 55536744 |
| Molecular Formula | C17H15N3O2S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | N-(2-benzamidoethyl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCNC(=O)c1csc(-c2cccs2)n1)c1ccccc1 |
| InChI | InChI=1S/C17H15N3O2S2/c21-15(12-5-2-1-3-6-12)18-8-9-19-16(22)13-11-24-17(20-13)14-7-4-10-23-14/h1-7,10-11H,8-9H2,(H,18,21)(H,19,22) |
| InChIKey | FVRYAEIJQTXGJH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|