C14H16N2O3S2 — CID 37258646
ethyl 4-[(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)amino]butanoate (PubChem CID 37258646) has the molecular formula C14H16N2O3S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is ethyl 4-[(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)amino]butanoate.
| Compound Name | ethyl 4-[(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 37258646 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | ethyl 4-[(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)c1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C14H16N2O3S2/c1-2-19-12(17)6-3-7-15-13(18)10-9-21-14(16-10)11-5-4-8-20-11/h4-5,8-9H,2-3,6-7H2,1H3,(H,15,18) |
| InChIKey | SACCDJFLEQHADP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|