C13H13N5OS3 — CID 70756855
N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 70756855) has the molecular formula C13H13N5OS3 and a molecular weight of 351.48 g/mol. Its IUPAC name is N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 70756855 |
| Molecular Formula | C13H13N5OS3 |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(SCCNC(=O)c2csc(-c3cccs3)n2)n[nH]1 |
| InChI | InChI=1S/C13H13N5OS3/c1-8-15-13(18-17-8)21-6-4-14-11(19)9-7-22-12(16-9)10-3-2-5-20-10/h2-3,5,7H,4,6H2,1H3,(H,14,19)(H,15,17,18) |
| InChIKey | ZFFULBWERUWGOC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|