C18H17N3O3S2 — CID 60517349
4-hydroxy-N-[2-[[2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetyl]amino]ethyl]benzamide (PubChem CID 60517349) has the molecular formula C18H17N3O3S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 4-hydroxy-N-[2-[[2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetyl]amino]ethyl]benzamide.
| Compound Name | 4-hydroxy-N-[2-[[2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 60517349 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 4-hydroxy-N-[2-[[2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetyl]amino]ethyl]benzamide |
| SMILES | O=C(Cc1csc(-c2cccs2)n1)NCCNC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H17N3O3S2/c22-14-5-3-12(4-6-14)17(24)20-8-7-19-16(23)10-13-11-26-18(21-13)15-2-1-9-25-15/h1-6,9,11,22H,7-8,10H2,(H,19,23)(H,20,24) |
| InChIKey | NJBFOWTUQDTXAE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|