C18H17FN2OS3 — CID 27895338
N-[3-(4-fluorophenyl)sulfanylpropyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 27895338) has the molecular formula C18H17FN2OS3 and a molecular weight of 392.55 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)sulfanylpropyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[3-(4-fluorophenyl)sulfanylpropyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 27895338 |
| Molecular Formula | C18H17FN2OS3 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | N-[3-(4-fluorophenyl)sulfanylpropyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | O=C(Cc1csc(-c2cccs2)n1)NCCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FN2OS3/c19-13-4-6-15(7-5-13)23-10-2-8-20-17(22)11-14-12-25-18(21-14)16-3-1-9-24-16/h1,3-7,9,12H,2,8,10-11H2,(H,20,22) |
| InChIKey | VNKMWAGAAQUKTH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|