C13H17N3OS2 — CID 119508736
N-[2-(ethylamino)ethyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 119508736) has the molecular formula C13H17N3OS2 and a molecular weight of 295.43 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[2-(ethylamino)ethyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 119508736 |
| Molecular Formula | C13H17N3OS2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | CCNCCNC(=O)Cc1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C13H17N3OS2/c1-2-14-5-6-15-12(17)8-10-9-19-13(16-10)11-4-3-7-18-11/h3-4,7,9,14H,2,5-6,8H2,1H3,(H,15,17) |
| InChIKey | SRCBZRSTAAXBLT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|