C14H20Cl2N4OS — CID 119506122
N-[2-(ethylamino)ethyl]-2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetamide;dihydrochloride (PubChem CID 119506122) has the molecular formula C14H20Cl2N4OS and a molecular weight of 363.31 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetamide;dihydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119506122 |
| Molecular Formula | C14H20Cl2N4OS |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetamide;dihydrochloride |
| SMILES | CCNCCNC(=O)Cc1csc(-c2ccccn2)n1.Cl.Cl |
| InChI | InChI=1S/C14H18N4OS.2ClH/c1-2-15-7-8-17-13(19)9-11-10-20-14(18-11)12-5-3-4-6-16-12;;/h3-6,10,15H,2,7-9H2,1H3,(H,17,19);2*1H |
| InChIKey | FPUXTJYDPKINJQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|