C18H16N6OS — CID 47037231
N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 47037231) has the molecular formula C18H16N6OS and a molecular weight of 364.43 g/mol. Its IUPAC name is N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 47037231 |
| Molecular Formula | C18H16N6OS |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2-(2-pyridin-2-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | N#Cc1cccnc1NCCNC(=O)Cc1csc(-c2ccccn2)n1 |
| InChI | InChI=1S/C18H16N6OS/c19-11-13-4-3-7-22-17(13)23-9-8-21-16(25)10-14-12-26-18(24-14)15-5-1-2-6-20-15/h1-7,12H,8-10H2,(H,21,25)(H,22,23) |
| InChIKey | CEJZVHHKIQVPSW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|