C13H16ClN3OS2 — CID 119509433
2-[2-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]-N-[2-(ethylamino)ethyl]acetamide (PubChem CID 119509433) has the molecular formula C13H16ClN3OS2 and a molecular weight of 329.88 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]-N-[2-(ethylamino)ethyl]acetamide.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]-N-[2-(ethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 119509433 |
| Molecular Formula | C13H16ClN3OS2 |
| Molecular Weight | 329.88 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]-N-[2-(ethylamino)ethyl]acetamide |
| SMILES | CCNCCNC(=O)Cc1csc(-c2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C13H16ClN3OS2/c1-2-15-5-6-16-12(18)7-9-8-19-13(17-9)10-3-4-11(14)20-10/h3-4,8,15H,2,5-7H2,1H3,(H,16,18) |
| InChIKey | WRMPGVWJHULFPY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.88 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|