C21H22FN3OS2 — CID 58757056
2-(4-fluorophenyl)sulfanyl-N-[5-(2-pyridin-4-yl-1,3-thiazol-4-yl)pentyl]acetamide (PubChem CID 58757056) has the molecular formula C21H22FN3OS2 and a molecular weight of 415.56 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfanyl-N-[5-(2-pyridin-4-yl-1,3-thiazol-4-yl)pentyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)sulfanyl-N-[5-(2-pyridin-4-yl-1,3-thiazol-4-yl)pentyl]acetamide |
|---|---|
| PubChem CID | 58757056 |
| Molecular Formula | C21H22FN3OS2 |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-(4-fluorophenyl)sulfanyl-N-[5-(2-pyridin-4-yl-1,3-thiazol-4-yl)pentyl]acetamide |
| SMILES | O=C(CSc1ccc(F)cc1)NCCCCCc1csc(-c2ccncc2)n1 |
| InChI | InChI=1S/C21H22FN3OS2/c22-17-5-7-19(8-6-17)27-15-20(26)24-11-3-1-2-4-18-14-28-21(25-18)16-9-12-23-13-10-16/h5-10,12-14H,1-4,11,15H2,(H,24,26) |
| InChIKey | JMPJVJIEULNVQR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|