C12H10N2O5S2 — CID 112733132
(2S)-2-[(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)amino]butanedioic acid (PubChem CID 112733132) has the molecular formula C12H10N2O5S2 and a molecular weight of 326.36 g/mol. Its IUPAC name is (2S)-2-[(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)amino]butanedioic acid.
| Compound Name | (2S)-2-[(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 112733132 |
| Molecular Formula | C12H10N2O5S2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | (2S)-2-[(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)amino]butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)c1csc(-c2cccs2)n1)C(=O)O |
| InChI | InChI=1S/C12H10N2O5S2/c15-9(16)4-6(12(18)19)13-10(17)7-5-21-11(14-7)8-2-1-3-20-8/h1-3,5-6H,4H2,(H,13,17)(H,15,16)(H,18,19)/t6-/m0/s1 |
| InChIKey | VYINTRVCEUIUNK-LURJTMIESA-N |
| XLogP | 1.53 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |