3-(2-thiophen-2-yl-1,3-thiazol-4-yl)butanoic acid

C11H11NO2S2 — CID 116889223

IUPAC3-(2-thiophen-2-yl-1,3-thiazol-4-yl)butanoic acid
SMILESCC(CC(=O)O)c1csc(-c2cccs2)n1
InChIInChI=1S/C11H11NO2S2/c1-7(5-10(13)14)8-6-16-11(12-8)9-3-2-4-15-9/h2-4,6-7H,5H2,1H3,(H,13,14)
InChIKeySLTIEFVOTXIXAF-UHFFFAOYSA-N
MW253.35 g/mol
LogP3.45
Rot. Bonds4

About 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)butanoic acid

3-(2-thiophen-2-yl-1,3-thiazol-4-yl)butanoic acid (PubChem CID 116889223) has the molecular formula C11H11NO2S2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)butanoic acid.

Molecular Properties

Compound Name3-(2-thiophen-2-yl-1,3-thiazol-4-yl)butanoic acid
PubChem CID116889223
Molecular FormulaC11H11NO2S2
Molecular Weight253.35 g/mol
Exact Mass253.02
IUPAC Name3-(2-thiophen-2-yl-1,3-thiazol-4-yl)butanoic acid
SMILESCC(CC(=O)O)c1csc(-c2cccs2)n1
InChIInChI=1S/C11H11NO2S2/c1-7(5-10(13)14)8-6-16-11(12-8)9-3-2-4-15-9/h2-4,6-7H,5H2,1H3,(H,13,14)
InChIKeySLTIEFVOTXIXAF-UHFFFAOYSA-N
XLogP3.45
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.35
LogP ≤ 53.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)butanoic acid?
The IUPAC name of 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)butanoic acid (CID 116889223) is 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)butanoic acid.
What is the SMILES notation for 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)butanoic acid?
The canonical SMILES for 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)butanoic acid is CC(CC(=O)O)c1csc(-c2cccs2)n1.
What is the InChIKey of 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)butanoic acid?
The InChIKey is SLTIEFVOTXIXAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2S2/c1-7(5-10(13)14)8-6-16-11(12-8)9-3-2-4-15-9/h2-4,6-7H,5H2,1H3,(H,13,14).
What are the key properties of 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)butanoic acid?
3-(2-thiophen-2-yl-1,3-thiazol-4-yl)butanoic acid has a molecular weight of 253.35 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-thiophen-2-yl-1,3-thiazol-4-yl)butanoic acid is sourced from PubChem (CID 116889223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).