C16H16N2O7S — CID 155964490
2-[[2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carbonyl]amino]butanedioic acid (PubChem CID 155964490) has the molecular formula C16H16N2O7S and a molecular weight of 380.38 g/mol. Its IUPAC name is 2-[[2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carbonyl]amino]butanedioic acid.
| Compound Name | 2-[[2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carbonyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 155964490 |
| Molecular Formula | C16H16N2O7S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-[[2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carbonyl]amino]butanedioic acid |
| SMILES | COc1ccc(-c2nc(C(=O)NC(CC(=O)O)C(=O)O)cs2)cc1OC |
| InChI | InChI=1S/C16H16N2O7S/c1-24-11-4-3-8(5-12(11)25-2)15-18-10(7-26-15)14(21)17-9(16(22)23)6-13(19)20/h3-5,7,9H,6H2,1-2H3,(H,17,21)(H,19,20)(H,22,23) |
| InChIKey | GFTCDJHCWSXDDT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 135.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |