C17H21N3O5S — CID 18157378
2-(3,4-dimethoxyphenyl)-N-[2-(2-methoxyethylamino)-2-oxoethyl]-1,3-thiazole-4-carboxamide (PubChem CID 18157378) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[2-(2-methoxyethylamino)-2-oxoethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[2-(2-methoxyethylamino)-2-oxoethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 18157378 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[2-(2-methoxyethylamino)-2-oxoethyl]-1,3-thiazole-4-carboxamide |
| SMILES | COCCNC(=O)CNC(=O)c1csc(-c2ccc(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C17H21N3O5S/c1-23-7-6-18-15(21)9-19-16(22)12-10-26-17(20-12)11-4-5-13(24-2)14(8-11)25-3/h4-5,8,10H,6-7,9H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | HOHGMSQKKNHTSC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|