C21H22N4O2S — CID 18135858
N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-phenyl-3-thiophen-2-ylpyrazole-5-carboxamide (PubChem CID 18135858) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-phenyl-3-thiophen-2-ylpyrazole-5-carboxamide.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-phenyl-3-thiophen-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 18135858 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-1-phenyl-3-thiophen-2-ylpyrazole-5-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1cc(-c2cccs2)nn1-c1ccccc1 |
| InChI | InChI=1S/C21H22N4O2S/c26-20-10-4-12-24(20)13-6-11-22-21(27)18-15-17(19-9-5-14-28-19)23-25(18)16-7-2-1-3-8-16/h1-3,5,7-9,14-15H,4,6,10-13H2,(H,22,27) |
| InChIKey | XNMCZJDXUCRJEO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|