C20H21Cl2N3OS — CID 4537760
1-(3,4-dichlorophenyl)-N-hexyl-3-thiophen-2-ylpyrazole-5-carboxamide (PubChem CID 4537760) has the molecular formula C20H21Cl2N3OS and a molecular weight of 422.38 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-hexyl-3-thiophen-2-ylpyrazole-5-carboxamide.
| Compound Name | 1-(3,4-dichlorophenyl)-N-hexyl-3-thiophen-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4537760 |
| Molecular Formula | C20H21Cl2N3OS |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-hexyl-3-thiophen-2-ylpyrazole-5-carboxamide |
| SMILES | CCCCCCNC(=O)c1cc(-c2cccs2)nn1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H21Cl2N3OS/c1-2-3-4-5-10-23-20(26)18-13-17(19-7-6-11-27-19)24-25(18)14-8-9-15(21)16(22)12-14/h6-9,11-13H,2-5,10H2,1H3,(H,23,26) |
| InChIKey | AYNLQZMVXCHJSA-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|