C16H14ClN3O2S — CID 42761829
1-(4-chlorophenyl)-N-ethoxy-3-thiophen-2-ylpyrazole-5-carboxamide (PubChem CID 42761829) has the molecular formula C16H14ClN3O2S and a molecular weight of 347.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-ethoxy-3-thiophen-2-ylpyrazole-5-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-ethoxy-3-thiophen-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42761829 |
| Molecular Formula | C16H14ClN3O2S |
| Molecular Weight | 347.83 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 1-(4-chlorophenyl)-N-ethoxy-3-thiophen-2-ylpyrazole-5-carboxamide |
| SMILES | CCONC(=O)c1cc(-c2cccs2)nn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClN3O2S/c1-2-22-19-16(21)14-10-13(15-4-3-9-23-15)18-20(14)12-7-5-11(17)6-8-12/h3-10H,2H2,1H3,(H,19,21) |
| InChIKey | DIHNWAJPTQDQAW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.83 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|