C22H18ClN3OS — CID 7414159
1-(4-chlorophenyl)-N-[(1S)-1-phenylethyl]-3-thiophen-2-ylpyrazole-5-carboxamide (PubChem CID 7414159) has the molecular formula C22H18ClN3OS and a molecular weight of 407.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(1S)-1-phenylethyl]-3-thiophen-2-ylpyrazole-5-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[(1S)-1-phenylethyl]-3-thiophen-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 7414159 |
| Molecular Formula | C22H18ClN3OS |
| Molecular Weight | 407.93 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(1S)-1-phenylethyl]-3-thiophen-2-ylpyrazole-5-carboxamide |
| SMILES | C[C@H](NC(=O)c1cc(-c2cccs2)nn1-c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H18ClN3OS/c1-15(16-6-3-2-4-7-16)24-22(27)20-14-19(21-8-5-13-28-21)25-26(20)18-11-9-17(23)10-12-18/h2-15H,1H3,(H,24,27)/t15-/m0/s1 |
| InChIKey | YXVCJUBYGPBCGA-HNNXBMFYSA-N |
| XLogP | 5.75 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.93 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |