C23H20N4O — CID 40551886
1,3-diphenyl-N-[(1R)-1-pyridin-4-ylethyl]pyrazole-5-carboxamide (PubChem CID 40551886) has the molecular formula C23H20N4O and a molecular weight of 368.44 g/mol. Its IUPAC name is 1,3-diphenyl-N-[(1R)-1-pyridin-4-ylethyl]pyrazole-5-carboxamide.
| Compound Name | 1,3-diphenyl-N-[(1R)-1-pyridin-4-ylethyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 40551886 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1,3-diphenyl-N-[(1R)-1-pyridin-4-ylethyl]pyrazole-5-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cc(-c2ccccc2)nn1-c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C23H20N4O/c1-17(18-12-14-24-15-13-18)25-23(28)22-16-21(19-8-4-2-5-9-19)26-27(22)20-10-6-3-7-11-20/h2-17H,1H3,(H,25,28)/t17-/m1/s1 |
| InChIKey | HEQICYRSERRMAJ-QGZVFWFLSA-N |
| XLogP | 4.43 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |