C20H22Cl2N4O — CID 3517534
1-(3,4-dichlorophenyl)-3-(1-methylpyrrol-2-yl)-N-pentylpyrazole-5-carboxamide (PubChem CID 3517534) has the molecular formula C20H22Cl2N4O and a molecular weight of 405.33 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(1-methylpyrrol-2-yl)-N-pentylpyrazole-5-carboxamide.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(1-methylpyrrol-2-yl)-N-pentylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3517534 |
| Molecular Formula | C20H22Cl2N4O |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(1-methylpyrrol-2-yl)-N-pentylpyrazole-5-carboxamide |
| SMILES | CCCCCNC(=O)c1cc(-c2cccn2C)nn1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H22Cl2N4O/c1-3-4-5-10-23-20(27)19-13-17(18-7-6-11-25(18)2)24-26(19)14-8-9-15(21)16(22)12-14/h6-9,11-13H,3-5,10H2,1-2H3,(H,23,27) |
| InChIKey | UYTPSBBSEKHTAW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|