C20H23ClN4O — CID 4301084
1-(3-chlorophenyl)-3-(1-methylpyrrol-2-yl)-N-pentylpyrazole-5-carboxamide (PubChem CID 4301084) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(1-methylpyrrol-2-yl)-N-pentylpyrazole-5-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-3-(1-methylpyrrol-2-yl)-N-pentylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4301084 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(1-methylpyrrol-2-yl)-N-pentylpyrazole-5-carboxamide |
| SMILES | CCCCCNC(=O)c1cc(-c2cccn2C)nn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H23ClN4O/c1-3-4-5-11-22-20(26)19-14-17(18-10-7-12-24(18)2)23-25(19)16-9-6-8-15(21)13-16/h6-10,12-14H,3-5,11H2,1-2H3,(H,22,26) |
| InChIKey | WGRXDFATOUIMMW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|