C17H16N4O3S — CID 42762114
1-(3-nitrophenyl)-N-propyl-3-thiophen-2-ylpyrazole-5-carboxamide (PubChem CID 42762114) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-N-propyl-3-thiophen-2-ylpyrazole-5-carboxamide.
| Compound Name | 1-(3-nitrophenyl)-N-propyl-3-thiophen-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42762114 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 1-(3-nitrophenyl)-N-propyl-3-thiophen-2-ylpyrazole-5-carboxamide |
| SMILES | CCCNC(=O)c1cc(-c2cccs2)nn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N4O3S/c1-2-8-18-17(22)15-11-14(16-7-4-9-25-16)19-20(15)12-5-3-6-13(10-12)21(23)24/h3-7,9-11H,2,8H2,1H3,(H,18,22) |
| InChIKey | NSZJEFGRSKSMQO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|