C30H27N5O3 — CID 42759024
N-(3,3-diphenylpropyl)-3-(1-methylpyrrol-2-yl)-1-(3-nitrophenyl)pyrazole-5-carboxamide (PubChem CID 42759024) has the molecular formula C30H27N5O3 and a molecular weight of 505.58 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-3-(1-methylpyrrol-2-yl)-1-(3-nitrophenyl)pyrazole-5-carboxamide.
| Compound Name | N-(3,3-diphenylpropyl)-3-(1-methylpyrrol-2-yl)-1-(3-nitrophenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42759024 |
| Molecular Formula | C30H27N5O3 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | N-(3,3-diphenylpropyl)-3-(1-methylpyrrol-2-yl)-1-(3-nitrophenyl)pyrazole-5-carboxamide |
| SMILES | Cn1cccc1-c1cc(C(=O)NCCC(c2ccccc2)c2ccccc2)n(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C30H27N5O3/c1-33-19-9-16-28(33)27-21-29(34(32-27)24-14-8-15-25(20-24)35(37)38)30(36)31-18-17-26(22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-16,19-21,26H,17-18H2,1H3,(H,31,36) |
| InChIKey | LHOPYZUZAUXENL-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|