C32H28N4O4 — CID 4010497
N-(3,3-diphenylpropyl)-3-(4-methoxyphenyl)-1-(3-nitrophenyl)pyrazole-5-carboxamide (PubChem CID 4010497) has the molecular formula C32H28N4O4 and a molecular weight of 532.60 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-3-(4-methoxyphenyl)-1-(3-nitrophenyl)pyrazole-5-carboxamide.
| Compound Name | N-(3,3-diphenylpropyl)-3-(4-methoxyphenyl)-1-(3-nitrophenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4010497 |
| Molecular Formula | C32H28N4O4 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | N-(3,3-diphenylpropyl)-3-(4-methoxyphenyl)-1-(3-nitrophenyl)pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCCC(c3ccccc3)c3ccccc3)n(-c3cccc([N+](=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C32H28N4O4/c1-40-28-17-15-25(16-18-28)30-22-31(35(34-30)26-13-8-14-27(21-26)36(38)39)32(37)33-20-19-29(23-9-4-2-5-10-23)24-11-6-3-7-12-24/h2-18,21-22,29H,19-20H2,1H3,(H,33,37) |
| InChIKey | KFJYKXSFFHULGH-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|