C31H25ClN4O3 — CID 42662908
1-(4-chlorophenyl)-N-(3,3-diphenylpropyl)-3-(4-nitrophenyl)pyrazole-5-carboxamide (PubChem CID 42662908) has the molecular formula C31H25ClN4O3 and a molecular weight of 537.02 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(3,3-diphenylpropyl)-3-(4-nitrophenyl)pyrazole-5-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-(3,3-diphenylpropyl)-3-(4-nitrophenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42662908 |
| Molecular Formula | C31H25ClN4O3 |
| Molecular Weight | 537.02 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(3,3-diphenylpropyl)-3-(4-nitrophenyl)pyrazole-5-carboxamide |
| SMILES | O=C(NCCC(c1ccccc1)c1ccccc1)c1cc(-c2ccc([N+](=O)[O-])cc2)nn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H25ClN4O3/c32-25-13-17-26(18-14-25)35-30(21-29(34-35)24-11-15-27(16-12-24)36(38)39)31(37)33-20-19-28(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-18,21,28H,19-20H2,(H,33,37) |
| InChIKey | SHMMQAZJIIJLBJ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.02 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|