C32H28N4O3 — CID 3946638
3-(3,4-dimethylphenyl)-N-(1,2-diphenylethyl)-1-(4-nitrophenyl)pyrazole-5-carboxamide (PubChem CID 3946638) has the molecular formula C32H28N4O3 and a molecular weight of 516.60 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-N-(1,2-diphenylethyl)-1-(4-nitrophenyl)pyrazole-5-carboxamide.
| Compound Name | 3-(3,4-dimethylphenyl)-N-(1,2-diphenylethyl)-1-(4-nitrophenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3946638 |
| Molecular Formula | C32H28N4O3 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-N-(1,2-diphenylethyl)-1-(4-nitrophenyl)pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NC(Cc3ccccc3)c3ccccc3)n(-c3ccc([N+](=O)[O-])cc3)n2)cc1C |
| InChI | InChI=1S/C32H28N4O3/c1-22-13-14-26(19-23(22)2)30-21-31(35(34-30)27-15-17-28(18-16-27)36(38)39)32(37)33-29(25-11-7-4-8-12-25)20-24-9-5-3-6-10-24/h3-19,21,29H,20H2,1-2H3,(H,33,37) |
| InChIKey | PAKVSFCLFQDWHA-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|